C37H33N4O6P3 — CID 23419286
[4-[(2,4,4,6,6-pentaphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl)oxy]phenyl]methanamine (PubChem CID 23419286) has the molecular formula C37H33N4O6P3 and a molecular weight of 722.62 g/mol. Its IUPAC name is [4-[(2,4,4,6,6-pentaphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl)oxy]phenyl]methanamine.
| Compound Name | [4-[(2,4,4,6,6-pentaphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl)oxy]phenyl]methanamine |
|---|---|
| PubChem CID | 23419286 |
| Molecular Formula | C37H33N4O6P3 |
| Molecular Weight | 722.62 g/mol |
| Exact Mass | 722.16 |
| IUPAC Name | [4-[(2,4,4,6,6-pentaphenoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-trien-2-yl)oxy]phenyl]methanamine |
| SMILES | NCc1ccc(OP2(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=NP(Oc3ccccc3)(Oc3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C37H33N4O6P3/c38-30-31-26-28-37(29-27-31)47-50(46-36-24-14-5-15-25-36)40-48(42-32-16-6-1-7-17-32,43-33-18-8-2-9-19-33)39-49(41-50,44-34-20-10-3-11-21-34)45-35-22-12-4-13-23-35/h1-29H,30,38H2 |
| InChIKey | RQGAJJGLAFBEKK-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.62 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|