C42H36Br6N3O6P3 — CID 13335082
2,2,4,4,6,6-hexakis[4-(bromomethyl)phenoxy]-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene (PubChem CID 13335082) has the molecular formula C42H36Br6N3O6P3 and a molecular weight of 1251.11 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexakis[4-(bromomethyl)phenoxy]-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | 2,2,4,4,6,6-hexakis[4-(bromomethyl)phenoxy]-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 13335082 |
| Molecular Formula | C42H36Br6N3O6P3 |
| Molecular Weight | 1251.11 g/mol |
| Exact Mass | 1244.69 |
| IUPAC Name | 2,2,4,4,6,6-hexakis[4-(bromomethyl)phenoxy]-1,3,5-triaza-2lambda5,4lambda5,6lambda5-triphosphacyclohexa-1,3,5-triene |
| SMILES | BrCc1ccc(OP2(Oc3ccc(CBr)cc3)=NP(Oc3ccc(CBr)cc3)(Oc3ccc(CBr)cc3)=NP(Oc3ccc(CBr)cc3)(Oc3ccc(CBr)cc3)=N2)cc1 |
| InChI | InChI=1S/C42H36Br6N3O6P3/c43-25-31-1-13-37(14-2-31)52-58(53-38-15-3-32(26-44)4-16-38)49-59(54-39-17-5-33(27-45)6-18-39,55-40-19-7-34(28-46)8-20-40)51-60(50-58,56-41-21-9-35(29-47)10-22-41)57-42-23-11-36(30-48)12-24-42/h1-24H,25-30H2 |
| InChIKey | ZEVWMFWRMYQPMD-UHFFFAOYSA-N |
| XLogP | 17.68 |
| TPSA | 92.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1251.11 |
| LogP ≤ 5 | 17.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|