C24H20F4N5O4P3 — CID 23419328
4,4,6,6-tetrakis(4-fluorophenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2-diamine (PubChem CID 23419328) has the molecular formula C24H20F4N5O4P3 and a molecular weight of 611.37 g/mol. Its IUPAC name is 4,4,6,6-tetrakis(4-fluorophenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2-diamine.
| Compound Name | 4,4,6,6-tetrakis(4-fluorophenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2-diamine |
|---|---|
| PubChem CID | 23419328 |
| Molecular Formula | C24H20F4N5O4P3 |
| Molecular Weight | 611.37 g/mol |
| Exact Mass | 611.07 |
| IUPAC Name | 4,4,6,6-tetrakis(4-fluorophenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene-2,2-diamine |
| SMILES | NP1(N)=NP(Oc2ccc(F)cc2)(Oc2ccc(F)cc2)=NP(Oc2ccc(F)cc2)(Oc2ccc(F)cc2)=N1 |
| InChI | InChI=1S/C24H20F4N5O4P3/c25-17-1-9-21(10-2-17)34-39(35-22-11-3-18(26)4-12-22)31-38(29,30)32-40(33-39,36-23-13-5-19(27)6-14-23)37-24-15-7-20(28)8-16-24/h1-16H,29-30H2 |
| InChIKey | MDKRDWZVVUHUPB-UHFFFAOYSA-N |
| XLogP | 8.63 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.37 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|