C42H36N21O6P3 — CID 25149547
2,2,4,4,6,6-hexakis[4-(azidomethyl)phenoxy]-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene (PubChem CID 25149547) has the molecular formula C42H36N21O6P3 and a molecular weight of 1023.81 g/mol. Its IUPAC name is 2,2,4,4,6,6-hexakis[4-(azidomethyl)phenoxy]-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | 2,2,4,4,6,6-hexakis[4-(azidomethyl)phenoxy]-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 25149547 |
| Molecular Formula | C42H36N21O6P3 |
| Molecular Weight | 1023.81 g/mol |
| Exact Mass | 1023.24 |
| IUPAC Name | 2,2,4,4,6,6-hexakis[4-(azidomethyl)phenoxy]-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
| SMILES | [N-]=[N+]=NCc1ccc(OP2(Oc3ccc(CN=[N+]=[N-])cc3)=NP(Oc3ccc(CN=[N+]=[N-])cc3)(Oc3ccc(CN=[N+]=[N-])cc3)=NP(Oc3ccc(CN=[N+]=[N-])cc3)(Oc3ccc(CN=[N+]=[N-])cc3)=N2)cc1 |
| InChI | InChI=1S/C42H36N21O6P3/c43-55-49-25-31-1-13-37(14-2-31)64-70(65-38-15-3-32(4-16-38)26-50-56-44)61-71(66-39-17-5-33(6-18-39)27-51-57-45,67-40-19-7-34(8-20-40)28-52-58-46)63-72(62-70,68-41-21-9-35(10-22-41)29-53-59-47)69-42-23-11-36(12-24-42)30-54-60-48/h1-24H,25-30H2 |
| InChIKey | DYXBMODMBHDTEG-UHFFFAOYSA-N |
| XLogP | 17.17 |
| TPSA | 385.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1023.81 |
| LogP ≤ 5 | 17.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|