C30H34N3O6P3 — CID 139877889
2,2,4,4-tetraphenoxy-6,6-dipropoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene (PubChem CID 139877889) has the molecular formula C30H34N3O6P3 and a molecular weight of 625.54 g/mol. Its IUPAC name is 2,2,4,4-tetraphenoxy-6,6-dipropoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | 2,2,4,4-tetraphenoxy-6,6-dipropoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 139877889 |
| Molecular Formula | C30H34N3O6P3 |
| Molecular Weight | 625.54 g/mol |
| Exact Mass | 625.17 |
| IUPAC Name | 2,2,4,4-tetraphenoxy-6,6-dipropoxy-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
| SMILES | CCCOP1(OCCC)=NP(Oc2ccccc2)(Oc2ccccc2)=NP(Oc2ccccc2)(Oc2ccccc2)=N1 |
| InChI | InChI=1S/C30H34N3O6P3/c1-3-25-34-40(35-26-4-2)31-41(36-27-17-9-5-10-18-27,37-28-19-11-6-12-20-28)33-42(32-40,38-29-21-13-7-14-22-29)39-30-23-15-8-16-24-30/h5-24H,3-4,25-26H2,1-2H3 |
| InChIKey | JBNBCESWHFHMDL-UHFFFAOYSA-N |
| XLogP | 11.01 |
| TPSA | 92.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.54 |
| LogP ≤ 5 | 11.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|