C32H56N4O8P4 — CID 139877972
2,2-bis(3-methylphenoxy)-4,4,6,6,8,8-hexapropoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene (PubChem CID 139877972) has the molecular formula C32H56N4O8P4 and a molecular weight of 748.72 g/mol. Its IUPAC name is 2,2-bis(3-methylphenoxy)-4,4,6,6,8,8-hexapropoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene.
| Compound Name | 2,2-bis(3-methylphenoxy)-4,4,6,6,8,8-hexapropoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 139877972 |
| Molecular Formula | C32H56N4O8P4 |
| Molecular Weight | 748.72 g/mol |
| Exact Mass | 748.30 |
| IUPAC Name | 2,2-bis(3-methylphenoxy)-4,4,6,6,8,8-hexapropoxy-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
| SMILES | CCCOP1(OCCC)=NP(OCCC)(OCCC)=NP(Oc2cccc(C)c2)(Oc2cccc(C)c2)=NP(OCCC)(OCCC)=N1 |
| InChI | InChI=1S/C32H56N4O8P4/c1-9-21-37-45(38-22-10-2)33-46(39-23-11-3,40-24-12-4)35-48(43-31-19-15-17-29(7)27-31,44-32-20-16-18-30(8)28-32)36-47(34-45,41-25-13-5)42-26-14-6/h15-20,27-28H,9-14,21-26H2,1-8H3 |
| InChIKey | XHMKXTNDZMTBAX-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 123.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.72 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|