C32H40N4O8P4 — CID 139877859
2,4,6,8-tetramethoxy-2,4,6,8-tetrakis(3-methylphenoxy)-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene (PubChem CID 139877859) has the molecular formula C32H40N4O8P4 and a molecular weight of 732.59 g/mol. Its IUPAC name is 2,4,6,8-tetramethoxy-2,4,6,8-tetrakis(3-methylphenoxy)-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene.
| Compound Name | 2,4,6,8-tetramethoxy-2,4,6,8-tetrakis(3-methylphenoxy)-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 139877859 |
| Molecular Formula | C32H40N4O8P4 |
| Molecular Weight | 732.59 g/mol |
| Exact Mass | 732.18 |
| IUPAC Name | 2,4,6,8-tetramethoxy-2,4,6,8-tetrakis(3-methylphenoxy)-1,3,5,7-tetraza-2λ5,4λ5,6λ5,8λ5-tetraphosphacycloocta-1,3,5,7-tetraene |
| SMILES | COP1(Oc2cccc(C)c2)=NP(OC)(Oc2cccc(C)c2)=NP(OC)(Oc2cccc(C)c2)=NP(OC)(Oc2cccc(C)c2)=N1 |
| InChI | InChI=1S/C32H40N4O8P4/c1-25-13-9-17-29(21-25)41-45(37-5)33-46(38-6,42-30-18-10-14-26(2)22-30)35-48(40-8,44-32-20-12-16-28(4)24-32)36-47(34-45,39-7)43-31-19-11-15-27(3)23-31/h9-24H,1-8H3 |
| InChIKey | REGMYCGGZOBFLC-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 123.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.59 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|