C12H13N3O3 — CID 121014438
2,4-dimethoxy-6-(3-methylphenoxy)-1,3,5-triazine (PubChem CID 121014438) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 2,4-dimethoxy-6-(3-methylphenoxy)-1,3,5-triazine.
| Compound Name | 2,4-dimethoxy-6-(3-methylphenoxy)-1,3,5-triazine |
|---|---|
| PubChem CID | 121014438 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2,4-dimethoxy-6-(3-methylphenoxy)-1,3,5-triazine |
| SMILES | COc1nc(OC)nc(Oc2cccc(C)c2)n1 |
| InChI | InChI=1S/C12H13N3O3/c1-8-5-4-6-9(7-8)18-12-14-10(16-2)13-11(15-12)17-3/h4-7H,1-3H3 |
| InChIKey | QDVYGFVDNPEXSS-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |