C18H15FN2O2 — CID 679767
5-fluoro-2,4-bis(3-methylphenoxy)pyrimidine (PubChem CID 679767) has the molecular formula C18H15FN2O2 and a molecular weight of 310.33 g/mol. Its IUPAC name is 5-fluoro-2,4-bis(3-methylphenoxy)pyrimidine.
| Compound Name | 5-fluoro-2,4-bis(3-methylphenoxy)pyrimidine |
|---|---|
| PubChem CID | 679767 |
| Molecular Formula | C18H15FN2O2 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 5-fluoro-2,4-bis(3-methylphenoxy)pyrimidine |
| SMILES | Cc1cccc(Oc2ncc(F)c(Oc3cccc(C)c3)n2)c1 |
| InChI | InChI=1S/C18H15FN2O2/c1-12-5-3-7-14(9-12)22-17-16(19)11-20-18(21-17)23-15-8-4-6-13(2)10-15/h3-11H,1-2H3 |
| InChIKey | ZJIQIXWHBMLKHK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |