C36H38N3O6P3 — CID 139877948
2-methoxy-2,4,4,6,6-pentakis(3-methylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene (PubChem CID 139877948) has the molecular formula C36H38N3O6P3 and a molecular weight of 701.64 g/mol. Its IUPAC name is 2-methoxy-2,4,4,6,6-pentakis(3-methylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene.
| Compound Name | 2-methoxy-2,4,4,6,6-pentakis(3-methylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 139877948 |
| Molecular Formula | C36H38N3O6P3 |
| Molecular Weight | 701.64 g/mol |
| Exact Mass | 701.20 |
| IUPAC Name | 2-methoxy-2,4,4,6,6-pentakis(3-methylphenoxy)-1,3,5-triaza-2λ5,4λ5,6λ5-triphosphacyclohexa-1,3,5-triene |
| SMILES | COP1(Oc2cccc(C)c2)=NP(Oc2cccc(C)c2)(Oc2cccc(C)c2)=NP(Oc2cccc(C)c2)(Oc2cccc(C)c2)=N1 |
| InChI | InChI=1S/C36H38N3O6P3/c1-27-12-7-17-32(22-27)41-46(40-6)37-47(42-33-18-8-13-28(2)23-33,43-34-19-9-14-29(3)24-34)39-48(38-46,44-35-20-10-15-30(4)25-35)45-36-21-11-16-31(5)26-36/h7-26H,1-6H3 |
| InChIKey | NWJGGXYIEMFKHL-UHFFFAOYSA-N |
| XLogP | 12.42 |
| TPSA | 92.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.64 |
| LogP ≤ 5 | 12.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|