About dibromozinc;1-methoxy-3-methylbenzene
dibromozinc;1-methoxy-3-methylbenzene (PubChem CID 174778631) has the molecular formula C8H10Br2OZn
and a molecular weight of 347.37 g/mol. Its IUPAC name is dibromozinc;1-methoxy-3-methylbenzene.
Molecular Properties
| Compound Name | dibromozinc;1-methoxy-3-methylbenzene |
| PubChem CID | 174778631 |
| Molecular Formula | C8H10Br2OZn |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 343.84 |
| IUPAC Name | dibromozinc;1-methoxy-3-methylbenzene |
| SMILES | Br[Zn]Br.COc1cccc(C)c1 |
| InChI | InChI=1S/C8H10O.2BrH.Zn/c1-7-4-3-5-8(6-7)9-2;;;/h3-6H,1-2H3;2*1H;/q;;;+2/p-2 |
| InChIKey | PWZARHHHZYDUIF-UHFFFAOYSA-L |
| XLogP | 3.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dibromozinc;1-methoxy-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibromozinc;1-methoxy-3-methylbenzene?
The IUPAC name of dibromozinc;1-methoxy-3-methylbenzene (CID 174778631) is dibromozinc;1-methoxy-3-methylbenzene.
What is the SMILES notation for dibromozinc;1-methoxy-3-methylbenzene?
The canonical SMILES for dibromozinc;1-methoxy-3-methylbenzene is Br[Zn]Br.COc1cccc(C)c1.
What is the InChIKey of dibromozinc;1-methoxy-3-methylbenzene?
The InChIKey is PWZARHHHZYDUIF-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H10O.2BrH.Zn/c1-7-4-3-5-8(6-7)9-2;;;/h3-6H,1-2H3;2*1H;/q;;;+2/p-2.
What are the key properties of dibromozinc;1-methoxy-3-methylbenzene?
dibromozinc;1-methoxy-3-methylbenzene has a molecular weight of 347.37 g/mol, XLogP of 3.69, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dibromozinc;1-methoxy-3-methylbenzene is sourced from PubChem (CID 174778631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).