C24H20F8N6O4P6 — CID 59283703
2,2,4,4,6,8,10,12-octafluoro-6,8,10,12-tetraphenoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene (PubChem CID 59283703) has the molecular formula C24H20F8N6O4P6 and a molecular weight of 794.29 g/mol. Its IUPAC name is 2,2,4,4,6,8,10,12-octafluoro-6,8,10,12-tetraphenoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene.
| Compound Name | 2,2,4,4,6,8,10,12-octafluoro-6,8,10,12-tetraphenoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 59283703 |
| Molecular Formula | C24H20F8N6O4P6 |
| Molecular Weight | 794.29 g/mol |
| Exact Mass | 793.98 |
| IUPAC Name | 2,2,4,4,6,8,10,12-octafluoro-6,8,10,12-tetraphenoxy-1,3,5,7,9,11-hexaza-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododeca-1,3,5,7,9,11-hexaene |
| SMILES | FP1(F)=NP(F)(F)=NP(F)(Oc2ccccc2)=NP(F)(Oc2ccccc2)=NP(F)(Oc2ccccc2)=NP(F)(Oc2ccccc2)=N1 |
| InChI | InChI=1S/C24H20F8N6O4P6/c25-43(26)33-44(27,28)35-46(30,40-22-15-7-2-8-16-22)37-48(32,42-24-19-11-4-12-20-24)38-47(31,41-23-17-9-3-10-18-23)36-45(29,34-43)39-21-13-5-1-6-14-21/h1-20H |
| InChIKey | JVHOLEMIJIXNHZ-UHFFFAOYSA-N |
| XLogP | 15.75 |
| TPSA | 111.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.29 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|