C12H8F2O — CID 13455928
1,3-difluoro-5-phenoxybenzene (PubChem CID 13455928) has the molecular formula C12H8F2O and a molecular weight of 206.19 g/mol. Its IUPAC name is 1,3-difluoro-5-phenoxybenzene.
| Compound Name | 1,3-difluoro-5-phenoxybenzene |
|---|---|
| PubChem CID | 13455928 |
| Molecular Formula | C12H8F2O |
| Molecular Weight | 206.19 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 1,3-difluoro-5-phenoxybenzene |
| SMILES | Fc1cc(F)cc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C12H8F2O/c13-9-6-10(14)8-12(7-9)15-11-4-2-1-3-5-11/h1-8H |
| InChIKey | FXGLOOHSKGPODA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |