C21H21BO3Si — CID 102520367
1,3,2-dioxaborinan-2-yloxy(triphenyl)silane (PubChem CID 102520367) has the molecular formula C21H21BO3Si and a molecular weight of 360.29 g/mol. Its IUPAC name is 1,3,2-dioxaborinan-2-yloxy(triphenyl)silane.
| Compound Name | 1,3,2-dioxaborinan-2-yloxy(triphenyl)silane |
|---|---|
| PubChem CID | 102520367 |
| Molecular Formula | C21H21BO3Si |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 1,3,2-dioxaborinan-2-yloxy(triphenyl)silane |
| SMILES | c1ccc([Si](OB2OCCCO2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H21BO3Si/c1-4-11-19(12-5-1)26(20-13-6-2-7-14-20,21-15-8-3-9-16-21)25-22-23-17-10-18-24-22/h1-9,11-16H,10,17-18H2 |
| InChIKey | PIPHHDDPRKNZSW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|