C15H15BO3 — CID 18541713
2-(3-phenoxyphenyl)-1,3,2-dioxaborinane (PubChem CID 18541713) has the molecular formula C15H15BO3 and a molecular weight of 254.09 g/mol. Its IUPAC name is 2-(3-phenoxyphenyl)-1,3,2-dioxaborinane.
| Compound Name | 2-(3-phenoxyphenyl)-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 18541713 |
| Molecular Formula | C15H15BO3 |
| Molecular Weight | 254.09 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(3-phenoxyphenyl)-1,3,2-dioxaborinane |
| SMILES | c1ccc(Oc2cccc(B3OCCCO3)c2)cc1 |
| InChI | InChI=1S/C15H15BO3/c1-2-7-14(8-3-1)19-15-9-4-6-13(12-15)16-17-10-5-11-18-16/h1-4,6-9,12H,5,10-11H2 |
| InChIKey | RWBKRVQPKWBYNU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.09 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|