C20H19BO2Si — CID 101421948
1,3,2-dioxaborolan-2-yl(triphenyl)silane (PubChem CID 101421948) has the molecular formula C20H19BO2Si and a molecular weight of 330.27 g/mol. Its IUPAC name is 1,3,2-dioxaborolan-2-yl(triphenyl)silane.
| Compound Name | 1,3,2-dioxaborolan-2-yl(triphenyl)silane |
|---|---|
| PubChem CID | 101421948 |
| Molecular Formula | C20H19BO2Si |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1,3,2-dioxaborolan-2-yl(triphenyl)silane |
| SMILES | c1ccc([Si](B2OCCO2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19BO2Si/c1-4-10-18(11-5-1)24(21-22-16-17-23-21,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-15H,16-17H2 |
| InChIKey | PPGDPPPUQFPNMT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|