C24H34B2O6Si — CID 11048939
diphenyl-bis[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]silane (PubChem CID 11048939) has the molecular formula C24H34B2O6Si and a molecular weight of 468.24 g/mol. Its IUPAC name is diphenyl-bis[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]silane.
| Compound Name | diphenyl-bis[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]silane |
|---|---|
| PubChem CID | 11048939 |
| Molecular Formula | C24H34B2O6Si |
| Molecular Weight | 468.24 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | diphenyl-bis[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)oxy]silane |
| SMILES | CC1(C)OB(O[Si](OB2OC(C)(C)C(C)(C)O2)(c2ccccc2)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H34B2O6Si/c1-21(2)22(3,4)28-25(27-21)31-33(19-15-11-9-12-16-19,20-17-13-10-14-18-20)32-26-29-23(5,6)24(7,8)30-26/h9-18H,1-8H3 |
| InChIKey | VHSWWORQJRKZNY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.24 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|