C19H29BO2Si — CID 154717065
dimethyl-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]silane (PubChem CID 154717065) has the molecular formula C19H29BO2Si and a molecular weight of 328.34 g/mol. Its IUPAC name is dimethyl-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]silane.
| Compound Name | dimethyl-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]silane |
|---|---|
| PubChem CID | 154717065 |
| Molecular Formula | C19H29BO2Si |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | dimethyl-phenyl-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-bicyclo[1.1.1]pentanyl]silane |
| SMILES | CC1(C)OB(C23CC([Si](C)(C)c4ccccc4)(C2)C3)OC1(C)C |
| InChI | InChI=1S/C19H29BO2Si/c1-16(2)17(3,4)22-20(21-16)18-12-19(13-18,14-18)23(5,6)15-10-8-7-9-11-15/h7-11H,12-14H2,1-6H3 |
| InChIKey | DTVZEZRKQKHOJS-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|