C22H27BO2Si — CID 102236944
dimethyl-phenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]silane (PubChem CID 102236944) has the molecular formula C22H27BO2Si and a molecular weight of 362.35 g/mol. Its IUPAC name is dimethyl-phenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]silane.
| Compound Name | dimethyl-phenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]silane |
|---|---|
| PubChem CID | 102236944 |
| Molecular Formula | C22H27BO2Si |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | dimethyl-phenyl-[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]silane |
| SMILES | CC1(C)OB(c2ccc(C#C[Si](C)(C)c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C22H27BO2Si/c1-21(2)22(3,4)25-23(24-21)19-14-12-18(13-15-19)16-17-26(5,6)20-10-8-7-9-11-20/h7-15H,1-6H3 |
| InChIKey | GSMIONULPHRHMJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|