C31H38B2O4Si — CID 122212489
ethenyl-methyl-bis[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]silane (PubChem CID 122212489) has the molecular formula C31H38B2O4Si and a molecular weight of 524.35 g/mol. Its IUPAC name is ethenyl-methyl-bis[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]silane.
| Compound Name | ethenyl-methyl-bis[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]silane |
|---|---|
| PubChem CID | 122212489 |
| Molecular Formula | C31H38B2O4Si |
| Molecular Weight | 524.35 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | ethenyl-methyl-bis[2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethynyl]silane |
| SMILES | C=C[Si](C)(C#Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1)C#Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C31H38B2O4Si/c1-11-38(10,22-20-24-12-16-26(17-13-24)32-34-28(2,3)29(4,5)35-32)23-21-25-14-18-27(19-15-25)33-36-30(6,7)31(8,9)37-33/h11-19H,1H2,2-10H3 |
| InChIKey | MJLAHECWRBHIBV-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|