C18H27BO2Si — CID 134067663
trimethyl-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-ynyl]silane (PubChem CID 134067663) has the molecular formula C18H27BO2Si and a molecular weight of 314.31 g/mol. Its IUPAC name is trimethyl-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-ynyl]silane.
| Compound Name | trimethyl-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-ynyl]silane |
|---|---|
| PubChem CID | 134067663 |
| Molecular Formula | C18H27BO2Si |
| Molecular Weight | 314.31 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | trimethyl-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-ynyl]silane |
| SMILES | CC1(C)OB(c2ccc(C#CC[Si](C)(C)C)cc2)OC1(C)C |
| InChI | InChI=1S/C18H27BO2Si/c1-17(2)18(3,4)21-19(20-17)16-12-10-15(11-13-16)9-8-14-22(5,6)7/h10-13H,14H2,1-7H3 |
| InChIKey | ULMOISCYXYQAKL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|