C15H19BClNO2 — CID 170468707
2-(4-chlorobut-1-ynyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (PubChem CID 170468707) has the molecular formula C15H19BClNO2 and a molecular weight of 291.59 g/mol. Its IUPAC name is 2-(4-chlorobut-1-ynyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine.
| Compound Name | 2-(4-chlorobut-1-ynyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
|---|---|
| PubChem CID | 170468707 |
| Molecular Formula | C15H19BClNO2 |
| Molecular Weight | 291.59 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-(4-chlorobut-1-ynyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| SMILES | CC1(C)OB(c2ccc(C#CCCCl)nc2)OC1(C)C |
| InChI | InChI=1S/C15H19BClNO2/c1-14(2)15(3,4)20-16(19-14)12-8-9-13(18-11-12)7-5-6-10-17/h8-9,11H,6,10H2,1-4H3 |
| InChIKey | XRPVZJUMVIFOJW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.59 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|