C14H20BNO3 — CID 169454216
3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]prop-2-en-1-ol (PubChem CID 169454216) has the molecular formula C14H20BNO3 and a molecular weight of 261.13 g/mol. Its IUPAC name is 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]prop-2-en-1-ol.
| Compound Name | 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 169454216 |
| Molecular Formula | C14H20BNO3 |
| Molecular Weight | 261.13 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]prop-2-en-1-ol |
| SMILES | CC1(C)OB(c2ccc(C=CCO)nc2)OC1(C)C |
| InChI | InChI=1S/C14H20BNO3/c1-13(2)14(3,4)19-15(18-13)11-7-8-12(16-10-11)6-5-9-17/h5-8,10,17H,9H2,1-4H3 |
| InChIKey | PHUFZJRAENVVNN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.13 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|