C12H18BN3O3 — CID 75487223
N-hydroxy-N'-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanimidamide (PubChem CID 75487223) has the molecular formula C12H18BN3O3 and a molecular weight of 263.11 g/mol. Its IUPAC name is N-hydroxy-N'-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanimidamide.
| Compound Name | N-hydroxy-N'-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanimidamide |
|---|---|
| PubChem CID | 75487223 |
| Molecular Formula | C12H18BN3O3 |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | N-hydroxy-N'-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]methanimidamide |
| SMILES | CC1(C)OB(c2ccc(/N=C/NO)nc2)OC1(C)C |
| InChI | InChI=1S/C12H18BN3O3/c1-11(2)12(3,4)19-13(18-11)9-5-6-10(14-7-9)15-8-16-17/h5-8,17H,1-4H3,(H,14,15,16) |
| InChIKey | XEZSVYQZEXCPGD-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 75.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|