C30H31BGeO2 — CID 169031106
triphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]germane (PubChem CID 169031106) has the molecular formula C30H31BGeO2 and a molecular weight of 507.00 g/mol. Its IUPAC name is triphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]germane.
| Compound Name | triphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]germane |
|---|---|
| PubChem CID | 169031106 |
| Molecular Formula | C30H31BGeO2 |
| Molecular Weight | 507.00 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | triphenyl-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]germane |
| SMILES | CC1(C)OB(c2ccc([Ge](c3ccccc3)(c3ccccc3)c3ccccc3)cc2)OC1(C)C |
| InChI | InChI=1S/C30H31BGeO2/c1-29(2)30(3,4)34-31(33-29)24-20-22-28(23-21-24)32(25-14-8-5-9-15-25,26-16-10-6-11-17-26)27-18-12-7-13-19-27/h5-23H,1-4H3 |
| InChIKey | HIBSZWQNTDRWBC-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.00 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|