C24H35BO2Si2 — CID 134904347
trimethyl-[(E)-1-[methyl(diphenyl)silyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane (PubChem CID 134904347) has the molecular formula C24H35BO2Si2 and a molecular weight of 422.53 g/mol. Its IUPAC name is trimethyl-[(E)-1-[methyl(diphenyl)silyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane.
| Compound Name | trimethyl-[(E)-1-[methyl(diphenyl)silyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane |
|---|---|
| PubChem CID | 134904347 |
| Molecular Formula | C24H35BO2Si2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | trimethyl-[(E)-1-[methyl(diphenyl)silyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]silane |
| SMILES | CC1(C)OB(/C=C(\[Si](C)(C)C)[Si](C)(c2ccccc2)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C24H35BO2Si2/c1-23(2)24(3,4)27-25(26-23)19-22(28(5,6)7)29(8,20-15-11-9-12-16-20)21-17-13-10-14-18-21/h9-19H,1-8H3/b22-19+ |
| InChIKey | SJCOMBLQTCCRSR-ZBJSNUHESA-N |
| XLogP | 4.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|