C21H33BO3Si — CID 166438777
trimethyl-[(2E,4E)-3-methyl-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienoxy]silane (PubChem CID 166438777) has the molecular formula C21H33BO3Si and a molecular weight of 372.39 g/mol. Its IUPAC name is trimethyl-[(2E,4E)-3-methyl-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienoxy]silane.
| Compound Name | trimethyl-[(2E,4E)-3-methyl-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienoxy]silane |
|---|---|
| PubChem CID | 166438777 |
| Molecular Formula | C21H33BO3Si |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.23 |
| IUPAC Name | trimethyl-[(2E,4E)-3-methyl-4-phenyl-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)penta-2,4-dienoxy]silane |
| SMILES | CC(=C\CO[Si](C)(C)C)/C(=C\B1OC(C)(C)C(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C21H33BO3Si/c1-17(14-15-23-26(6,7)8)19(18-12-10-9-11-13-18)16-22-24-20(2,3)21(4,5)25-22/h9-14,16H,15H2,1-8H3/b17-14+,19-16+ |
| InChIKey | PNBACGDOMZUGMB-LDWJSGITSA-N |
| XLogP | 5.50 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|