C28H39BO3Si — CID 102283711
[1-[(E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]cyclohexyl]oxy-diphenylsilane (PubChem CID 102283711) has the molecular formula C28H39BO3Si and a molecular weight of 462.52 g/mol. Its IUPAC name is [1-[(E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]cyclohexyl]oxy-diphenylsilane.
| Compound Name | [1-[(E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]cyclohexyl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 102283711 |
| Molecular Formula | C28H39BO3Si |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | [1-[(E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]cyclohexyl]oxy-diphenylsilane |
| SMILES | C/C(=C\B1OC(C)(C)C(C)(C)O1)CC1(O[SiH](c2ccccc2)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C28H39BO3Si/c1-23(22-29-30-26(2,3)27(4,5)31-29)21-28(19-13-8-14-20-28)32-33(24-15-9-6-10-16-24)25-17-11-7-12-18-25/h6-7,9-12,15-18,22,33H,8,13-14,19-21H2,1-5H3/b23-22+ |
| InChIKey | RPECAVOOIVCTGB-GHVJWSGMSA-N |
| XLogP | 5.21 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|