C21H30BFO4 — CID 171111817
1-[[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]methyl]cyclohexan-1-ol (PubChem CID 171111817) has the molecular formula C21H30BFO4 and a molecular weight of 376.28 g/mol. Its IUPAC name is 1-[[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]methyl]cyclohexan-1-ol.
| Compound Name | 1-[[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 171111817 |
| Molecular Formula | C21H30BFO4 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-[[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]methyl]cyclohexan-1-ol |
| SMILES | CC1(C)OB(C(F)=Cc2ccccc2OCC2(O)CCCCC2)OC1(C)C |
| InChI | InChI=1S/C21H30BFO4/c1-19(2)20(3,4)27-22(26-19)18(23)14-16-10-6-7-11-17(16)25-15-21(24)12-8-5-9-13-21/h6-7,10-11,14,24H,5,8-9,12-13,15H2,1-4H3 |
| InChIKey | INYRTSHHEDXHIQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|