C19H21BFNO3 — CID 171111138
2-[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]pyridine (PubChem CID 171111138) has the molecular formula C19H21BFNO3 and a molecular weight of 341.19 g/mol. Its IUPAC name is 2-[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]pyridine.
| Compound Name | 2-[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]pyridine |
|---|---|
| PubChem CID | 171111138 |
| Molecular Formula | C19H21BFNO3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 2-[2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenoxy]pyridine |
| SMILES | CC1(C)OB(C(F)=Cc2ccccc2Oc2ccccn2)OC1(C)C |
| InChI | InChI=1S/C19H21BFNO3/c1-18(2)19(3,4)25-20(24-18)16(21)13-14-9-5-6-10-15(14)23-17-11-7-8-12-22-17/h5-13H,1-4H3 |
| InChIKey | SXTKSZFSILWNDX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|