C16H22O2 — CID 134894646
1-[(2R)-3,3-dimethyl-2-phenyloxiran-2-yl]cyclohexan-1-ol (PubChem CID 134894646) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 1-[(2R)-3,3-dimethyl-2-phenyloxiran-2-yl]cyclohexan-1-ol.
| Compound Name | 1-[(2R)-3,3-dimethyl-2-phenyloxiran-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 134894646 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 1-[(2R)-3,3-dimethyl-2-phenyloxiran-2-yl]cyclohexan-1-ol |
| SMILES | CC1(C)O[C@]1(c1ccccc1)C1(O)CCCCC1 |
| InChI | InChI=1S/C16H22O2/c1-14(2)16(18-14,13-9-5-3-6-10-13)15(17)11-7-4-8-12-15/h3,5-6,9-10,17H,4,7-8,11-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | WYHYJLDVOLKSOI-INIZCTEOSA-N |
| XLogP | 3.39 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|