C24H33BO3Si — CID 101418081
4-methylpent-1-en-3-yloxy-diphenyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane (PubChem CID 101418081) has the molecular formula C24H33BO3Si and a molecular weight of 408.42 g/mol. Its IUPAC name is 4-methylpent-1-en-3-yloxy-diphenyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane.
| Compound Name | 4-methylpent-1-en-3-yloxy-diphenyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane |
|---|---|
| PubChem CID | 101418081 |
| Molecular Formula | C24H33BO3Si |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | 4-methylpent-1-en-3-yloxy-diphenyl-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)silane |
| SMILES | C=CC(O[Si](B1OC(C)(C)C(C)(C)O1)(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C24H33BO3Si/c1-8-22(19(2)3)26-29(20-15-11-9-12-16-20,21-17-13-10-14-18-21)25-27-23(4,5)24(6,7)28-25/h8-19,22H,1H2,2-7H3 |
| InChIKey | DKJNRHIGVYQJHV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|