C29H35BO2Si — CID 139833210
[3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-triphenylsilane (PubChem CID 139833210) has the molecular formula C29H35BO2Si and a molecular weight of 454.50 g/mol. Its IUPAC name is [3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-triphenylsilane.
| Compound Name | [3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-triphenylsilane |
|---|---|
| PubChem CID | 139833210 |
| Molecular Formula | C29H35BO2Si |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.25 |
| IUPAC Name | [3-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-enyl]-triphenylsilane |
| SMILES | CC(C)=C(C[Si](c1ccccc1)(c1ccccc1)c1ccccc1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C29H35BO2Si/c1-23(2)27(30-31-28(3,4)29(5,6)32-30)22-33(24-16-10-7-11-17-24,25-18-12-8-13-19-25)26-20-14-9-15-21-26/h7-21H,22H2,1-6H3 |
| InChIKey | ZLLFTYBLWULWGL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|