C15H11F12O3P — CID 23417145
5-phenyl-2,2,3,3-tetrakis(trifluoromethyl)-1,4,6-trioxa-5λ5-phosphaspiro[4.4]nonane (PubChem CID 23417145) has the molecular formula C15H11F12O3P and a molecular weight of 498.20 g/mol. Its IUPAC name is 5-phenyl-2,2,3,3-tetrakis(trifluoromethyl)-1,4,6-trioxa-5λ5-phosphaspiro[4.4]nonane.
| Compound Name | 5-phenyl-2,2,3,3-tetrakis(trifluoromethyl)-1,4,6-trioxa-5λ5-phosphaspiro[4.4]nonane |
|---|---|
| PubChem CID | 23417145 |
| Molecular Formula | C15H11F12O3P |
| Molecular Weight | 498.20 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | 5-phenyl-2,2,3,3-tetrakis(trifluoromethyl)-1,4,6-trioxa-5λ5-phosphaspiro[4.4]nonane |
| SMILES | FC(F)(F)C1(C(F)(F)F)OP2(c3ccccc3)(CCCO2)OC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H11F12O3P/c16-12(17,18)10(13(19,20)21)11(14(22,23)24,15(25,26)27)30-31(29-10,8-4-7-28-31)9-5-2-1-3-6-9/h1-3,5-6H,4,7-8H2 |
| InChIKey | QBFCQCWMBVZZIF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.20 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|