C24H24F12NO4P — CID 102119317
N,N-diethyl-2,2-bis(phenylmethoxy)-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholan-2-amine (PubChem CID 102119317) has the molecular formula C24H24F12NO4P and a molecular weight of 649.41 g/mol. Its IUPAC name is N,N-diethyl-2,2-bis(phenylmethoxy)-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholan-2-amine.
| Compound Name | N,N-diethyl-2,2-bis(phenylmethoxy)-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholan-2-amine |
|---|---|
| PubChem CID | 102119317 |
| Molecular Formula | C24H24F12NO4P |
| Molecular Weight | 649.41 g/mol |
| Exact Mass | 649.13 |
| IUPAC Name | N,N-diethyl-2,2-bis(phenylmethoxy)-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholan-2-amine |
| SMILES | CCN(CC)P1(OCc2ccccc2)(OCc2ccccc2)OC(C(F)(F)F)(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)O1 |
| InChI | InChI=1S/C24H24F12NO4P/c1-3-37(4-2)42(38-15-17-11-7-5-8-12-17,39-16-18-13-9-6-10-14-18)40-19(21(25,26)27,22(28,29)30)20(41-42,23(31,32)33)24(34,35)36/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | JAYWCTAMKRURCF-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.41 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|