C18H10F13O2P — CID 23418974
2-fluoro-2,2-diphenyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholane (PubChem CID 23418974) has the molecular formula C18H10F13O2P and a molecular weight of 536.22 g/mol. Its IUPAC name is 2-fluoro-2,2-diphenyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholane.
| Compound Name | 2-fluoro-2,2-diphenyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholane |
|---|---|
| PubChem CID | 23418974 |
| Molecular Formula | C18H10F13O2P |
| Molecular Weight | 536.22 g/mol |
| Exact Mass | 536.02 |
| IUPAC Name | 2-fluoro-2,2-diphenyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2λ5-dioxaphospholane |
| SMILES | FC(F)(F)C1(C(F)(F)F)OP(F)(c2ccccc2)(c2ccccc2)OC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H10F13O2P/c19-15(20,21)13(16(22,23)24)14(17(25,26)27,18(28,29)30)33-34(31,32-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | UITXWEHZAYVORD-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.22 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|