C24H20F6NO2P — CID 23234978
2-methoxy-5-(4-methylphenyl)-2,2-diphenyl-3,3-bis(trifluoromethyl)-1,4,2λ5-oxazaphosphole (PubChem CID 23234978) has the molecular formula C24H20F6NO2P and a molecular weight of 499.39 g/mol. Its IUPAC name is 2-methoxy-5-(4-methylphenyl)-2,2-diphenyl-3,3-bis(trifluoromethyl)-1,4,2λ5-oxazaphosphole.
| Compound Name | 2-methoxy-5-(4-methylphenyl)-2,2-diphenyl-3,3-bis(trifluoromethyl)-1,4,2λ5-oxazaphosphole |
|---|---|
| PubChem CID | 23234978 |
| Molecular Formula | C24H20F6NO2P |
| Molecular Weight | 499.39 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2-methoxy-5-(4-methylphenyl)-2,2-diphenyl-3,3-bis(trifluoromethyl)-1,4,2λ5-oxazaphosphole |
| SMILES | COP1(c2ccccc2)(c2ccccc2)OC(c2ccc(C)cc2)=NC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C24H20F6NO2P/c1-17-13-15-18(16-14-17)21-31-22(23(25,26)27,24(28,29)30)34(32-2,33-21,19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-16H,1-2H3 |
| InChIKey | QGXQCJBFYCLOJZ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.39 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|