C28H28F6NO2P — CID 23417115
3,3-dimethoxy-3,5-diphenyl-2,2-bis(trifluoromethyl)-4-(2,4,6-trimethylphenyl)-4H-1,3λ5-azaphosphole (PubChem CID 23417115) has the molecular formula C28H28F6NO2P and a molecular weight of 555.50 g/mol. Its IUPAC name is 3,3-dimethoxy-3,5-diphenyl-2,2-bis(trifluoromethyl)-4-(2,4,6-trimethylphenyl)-4H-1,3λ5-azaphosphole.
| Compound Name | 3,3-dimethoxy-3,5-diphenyl-2,2-bis(trifluoromethyl)-4-(2,4,6-trimethylphenyl)-4H-1,3λ5-azaphosphole |
|---|---|
| PubChem CID | 23417115 |
| Molecular Formula | C28H28F6NO2P |
| Molecular Weight | 555.50 g/mol |
| Exact Mass | 555.18 |
| IUPAC Name | 3,3-dimethoxy-3,5-diphenyl-2,2-bis(trifluoromethyl)-4-(2,4,6-trimethylphenyl)-4H-1,3λ5-azaphosphole |
| SMILES | COP1(OC)(c2ccccc2)C(c2c(C)cc(C)cc2C)C(c2ccccc2)=NC1(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C28H28F6NO2P/c1-18-16-19(2)23(20(3)17-18)25-24(21-12-8-6-9-13-21)35-26(27(29,30)31,28(32,33)34)38(25,36-4,37-5)22-14-10-7-11-15-22/h6-17,25H,1-5H3 |
| InChIKey | FXDBROKYKIMVAD-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.50 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|