C25H28NO4P — CID 23417141
5,5-dimethoxy-2-oxido-3,5-diphenyl-4-(2,4,6-trimethylphenyl)-4H-1,2,5λ5-oxazaphosphol-2-ium (PubChem CID 23417141) has the molecular formula C25H28NO4P and a molecular weight of 437.48 g/mol. Its IUPAC name is 5,5-dimethoxy-2-oxido-3,5-diphenyl-4-(2,4,6-trimethylphenyl)-4H-1,2,5λ5-oxazaphosphol-2-ium.
| Compound Name | 5,5-dimethoxy-2-oxido-3,5-diphenyl-4-(2,4,6-trimethylphenyl)-4H-1,2,5λ5-oxazaphosphol-2-ium |
|---|---|
| PubChem CID | 23417141 |
| Molecular Formula | C25H28NO4P |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 5,5-dimethoxy-2-oxido-3,5-diphenyl-4-(2,4,6-trimethylphenyl)-4H-1,2,5λ5-oxazaphosphol-2-ium |
| SMILES | COP1(OC)(c2ccccc2)O[N+]([O-])=C(c2ccccc2)C1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H28NO4P/c1-18-16-19(2)23(20(3)17-18)25-24(21-12-8-6-9-13-21)26(27)30-31(25,28-4,29-5)22-14-10-7-11-15-22/h6-17,25H,1-5H3 |
| InChIKey | XKUDFXPSGSIUDK-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|