C19H24NO4P — CID 102032189
diethyl [(Z)-1-naphthalen-2-ylpent-4-enylideneamino] phosphate (PubChem CID 102032189) has the molecular formula C19H24NO4P and a molecular weight of 361.38 g/mol. Its IUPAC name is diethyl [(Z)-1-naphthalen-2-ylpent-4-enylideneamino] phosphate.
| Compound Name | diethyl [(Z)-1-naphthalen-2-ylpent-4-enylideneamino] phosphate |
|---|---|
| PubChem CID | 102032189 |
| Molecular Formula | C19H24NO4P |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.14 |
| IUPAC Name | diethyl [(Z)-1-naphthalen-2-ylpent-4-enylideneamino] phosphate |
| SMILES | C=CCC/C(=N/OP(=O)(OCC)OCC)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H24NO4P/c1-4-7-12-19(20-24-25(21,22-5-2)23-6-3)18-14-13-16-10-8-9-11-17(16)15-18/h4,8-11,13-15H,1,5-7,12H2,2-3H3/b20-19- |
| InChIKey | FWULIENGFMUOQV-VXPUYCOJSA-N |
| XLogP | 5.71 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|