C13H12NO4P — CID 3079434
(3-naphthalen-1-yl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid (PubChem CID 3079434) has the molecular formula C13H12NO4P and a molecular weight of 277.22 g/mol. Its IUPAC name is (3-naphthalen-1-yl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid.
| Compound Name | (3-naphthalen-1-yl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid |
|---|---|
| PubChem CID | 3079434 |
| Molecular Formula | C13H12NO4P |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | (3-naphthalen-1-yl-4,5-dihydro-1,2-oxazol-5-yl)phosphonic acid |
| SMILES | O=P(O)(O)C1CC(c2cccc3ccccc23)=NO1 |
| InChI | InChI=1S/C13H12NO4P/c15-19(16,17)13-8-12(14-18-13)11-7-3-5-9-4-1-2-6-10(9)11/h1-7,13H,8H2,(H2,15,16,17) |
| InChIKey | GKZLCOMMWSYYFC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|