C24H30NO4P — CID 138984335
(E)-2-[2-[(E)-2-diethoxyphosphorylethenyl]naphthalen-1-yl]-N-methoxy-3-methylcyclohex-2-en-1-imine (PubChem CID 138984335) has the molecular formula C24H30NO4P and a molecular weight of 427.48 g/mol. Its IUPAC name is (E)-2-[2-[(E)-2-diethoxyphosphorylethenyl]naphthalen-1-yl]-N-methoxy-3-methylcyclohex-2-en-1-imine.
| Compound Name | (E)-2-[2-[(E)-2-diethoxyphosphorylethenyl]naphthalen-1-yl]-N-methoxy-3-methylcyclohex-2-en-1-imine |
|---|---|
| PubChem CID | 138984335 |
| Molecular Formula | C24H30NO4P |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (E)-2-[2-[(E)-2-diethoxyphosphorylethenyl]naphthalen-1-yl]-N-methoxy-3-methylcyclohex-2-en-1-imine |
| SMILES | CCOP(=O)(/C=C/c1ccc2ccccc2c1C1=C(C)CCC/C1=N\OC)OCC |
| InChI | InChI=1S/C24H30NO4P/c1-5-28-30(26,29-6-2)17-16-20-15-14-19-11-7-8-12-21(19)24(20)23-18(3)10-9-13-22(23)25-27-4/h7-8,11-12,14-17H,5-6,9-10,13H2,1-4H3/b17-16+,25-22+ |
| InChIKey | FZHBJNUJUXGAFR-AFDOQIGGSA-N |
| XLogP | 7.04 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|