C20H30O6P2 — CID 102527414
2-[2,2-bis(diethoxyphosphoryl)ethyl]naphthalene (PubChem CID 102527414) has the molecular formula C20H30O6P2 and a molecular weight of 428.40 g/mol. Its IUPAC name is 2-[2,2-bis(diethoxyphosphoryl)ethyl]naphthalene.
| Compound Name | 2-[2,2-bis(diethoxyphosphoryl)ethyl]naphthalene |
|---|---|
| PubChem CID | 102527414 |
| Molecular Formula | C20H30O6P2 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 2-[2,2-bis(diethoxyphosphoryl)ethyl]naphthalene |
| SMILES | CCOP(=O)(OCC)C(Cc1ccc2ccccc2c1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C20H30O6P2/c1-5-23-27(21,24-6-2)20(28(22,25-7-3)26-8-4)16-17-13-14-18-11-9-10-12-19(18)15-17/h9-15,20H,5-8,16H2,1-4H3 |
| InChIKey | AFYITVZUAGOMNZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|