C21H32NO4P — CID 56971210
[(E)-[1-[(1R,2S)-2-ethenylcyclohexyl]-3-phenylpropylidene]amino] diethyl phosphate (PubChem CID 56971210) has the molecular formula C21H32NO4P and a molecular weight of 393.46 g/mol. Its IUPAC name is [(E)-[1-[(1R,2S)-2-ethenylcyclohexyl]-3-phenylpropylidene]amino] diethyl phosphate.
| Compound Name | [(E)-[1-[(1R,2S)-2-ethenylcyclohexyl]-3-phenylpropylidene]amino] diethyl phosphate |
|---|---|
| PubChem CID | 56971210 |
| Molecular Formula | C21H32NO4P |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | [(E)-[1-[(1R,2S)-2-ethenylcyclohexyl]-3-phenylpropylidene]amino] diethyl phosphate |
| SMILES | C=C[C@@H]1CCCC[C@H]1/C(CCc1ccccc1)=N/OP(=O)(OCC)OCC |
| InChI | InChI=1S/C21H32NO4P/c1-4-19-14-10-11-15-20(19)21(17-16-18-12-8-7-9-13-18)22-26-27(23,24-5-2)25-6-3/h4,7-9,12-13,19-20H,1,5-6,10-11,14-17H2,2-3H3/b22-21+/t19-,20-/m1/s1 |
| InChIKey | SCODLYKUWMEDQF-MRLDMXRXSA-N |
| XLogP | 6.17 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|