C17H24NO4P — CID 135079950
diethyl [(Z)-(2-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] phosphate (PubChem CID 135079950) has the molecular formula C17H24NO4P and a molecular weight of 337.36 g/mol. Its IUPAC name is diethyl [(Z)-(2-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] phosphate.
| Compound Name | diethyl [(Z)-(2-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] phosphate |
|---|---|
| PubChem CID | 135079950 |
| Molecular Formula | C17H24NO4P |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | diethyl [(Z)-(2-prop-2-enyl-3,4-dihydro-2H-naphthalen-1-ylidene)amino] phosphate |
| SMILES | C=CCC1CCc2ccccc2/C1=N\OP(=O)(OCC)OCC |
| InChI | InChI=1S/C17H24NO4P/c1-4-9-15-13-12-14-10-7-8-11-16(14)17(15)18-22-23(19,20-5-2)21-6-3/h4,7-8,10-11,15H,1,5-6,9,12-13H2,2-3H3/b18-17- |
| InChIKey | GYYLOIWESUPUGH-ZCXUNETKSA-N |
| XLogP | 4.73 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|