C17H23NO — CID 134964908
(E)-8-[(E)-hex-1-enyl]-N-methoxy-3,4-dihydro-2H-naphthalen-1-imine (PubChem CID 134964908) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is (E)-8-[(E)-hex-1-enyl]-N-methoxy-3,4-dihydro-2H-naphthalen-1-imine.
| Compound Name | (E)-8-[(E)-hex-1-enyl]-N-methoxy-3,4-dihydro-2H-naphthalen-1-imine |
|---|---|
| PubChem CID | 134964908 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | (E)-8-[(E)-hex-1-enyl]-N-methoxy-3,4-dihydro-2H-naphthalen-1-imine |
| SMILES | CCCC/C=C/c1cccc2c1/C(=N/OC)CCC2 |
| InChI | InChI=1S/C17H23NO/c1-3-4-5-6-9-14-10-7-11-15-12-8-13-16(17(14)15)18-19-2/h6-7,9-11H,3-5,8,12-13H2,1-2H3/b9-6+,18-16+ |
| InChIKey | XTCSNMMNHVETTM-KLSKLXQRSA-N |
| XLogP | 4.58 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|