C13H14Cl2F4NO4P — CID 12689509
3,3-bis[chloro(difluoro)methyl]-2,2,2-trimethoxy-5-phenyl-1,4,2λ5-oxazaphosphole (PubChem CID 12689509) has the molecular formula C13H14Cl2F4NO4P and a molecular weight of 426.13 g/mol. Its IUPAC name is 3,3-bis[chloro(difluoro)methyl]-2,2,2-trimethoxy-5-phenyl-1,4,2λ5-oxazaphosphole.
| Compound Name | 3,3-bis[chloro(difluoro)methyl]-2,2,2-trimethoxy-5-phenyl-1,4,2λ5-oxazaphosphole |
|---|---|
| PubChem CID | 12689509 |
| Molecular Formula | C13H14Cl2F4NO4P |
| Molecular Weight | 426.13 g/mol |
| Exact Mass | 425.00 |
| IUPAC Name | 3,3-bis[chloro(difluoro)methyl]-2,2,2-trimethoxy-5-phenyl-1,4,2λ5-oxazaphosphole |
| SMILES | COP1(OC)(OC)OC(c2ccccc2)=NC1(C(F)(F)Cl)C(F)(F)Cl |
| InChI | InChI=1S/C13H14Cl2F4NO4P/c1-21-25(22-2,23-3)11(12(14,16)17,13(15,18)19)20-10(24-25)9-7-5-4-6-8-9/h4-8H,1-3H3 |
| InChIKey | OBMUWBFBNPVKRL-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.13 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|