C29H23NO2 — CID 14115752
(5Z)-5-benzylidene-2-(4-methoxyphenyl)-4,4-diphenyl-1,3-oxazole (PubChem CID 14115752) has the molecular formula C29H23NO2 and a molecular weight of 417.51 g/mol. Its IUPAC name is (5Z)-5-benzylidene-2-(4-methoxyphenyl)-4,4-diphenyl-1,3-oxazole.
| Compound Name | (5Z)-5-benzylidene-2-(4-methoxyphenyl)-4,4-diphenyl-1,3-oxazole |
|---|---|
| PubChem CID | 14115752 |
| Molecular Formula | C29H23NO2 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | (5Z)-5-benzylidene-2-(4-methoxyphenyl)-4,4-diphenyl-1,3-oxazole |
| SMILES | COc1ccc(C2=NC(c3ccccc3)(c3ccccc3)/C(=C/c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C29H23NO2/c1-31-26-19-17-23(18-20-26)28-30-29(24-13-7-3-8-14-24,25-15-9-4-10-16-25)27(32-28)21-22-11-5-2-6-12-22/h2-21H,1H3/b27-21- |
| InChIKey | MOMAUDDROWUOLH-MEFGMAGPSA-N |
| XLogP | 6.46 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |