C18H15NO5 — CID 101263641
phenyl (4R)-2-(4-methoxyphenyl)-4-methyl-5-oxo-1,3-oxazole-4-carboxylate (PubChem CID 101263641) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is phenyl (4R)-2-(4-methoxyphenyl)-4-methyl-5-oxo-1,3-oxazole-4-carboxylate.
| Compound Name | phenyl (4R)-2-(4-methoxyphenyl)-4-methyl-5-oxo-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 101263641 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | phenyl (4R)-2-(4-methoxyphenyl)-4-methyl-5-oxo-1,3-oxazole-4-carboxylate |
| SMILES | COc1ccc(C2=N[C@](C)(C(=O)Oc3ccccc3)C(=O)O2)cc1 |
| InChI | InChI=1S/C18H15NO5/c1-18(16(20)23-14-6-4-3-5-7-14)17(21)24-15(19-18)12-8-10-13(22-2)11-9-12/h3-11H,1-2H3/t18-/m1/s1 |
| InChIKey | UVQAQBGBVZIMFN-GOSISDBHSA-N |
| XLogP | 2.36 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|