C39H27NO8 — CID 53468965
naphthalen-1-yl 2-(4-methoxyphenyl)-4-[(4-naphthalen-1-yloxycarbonyloxyphenyl)methyl]-5-oxo-1,3-oxazole-4-carboxylate (PubChem CID 53468965) has the molecular formula C39H27NO8 and a molecular weight of 637.64 g/mol. Its IUPAC name is naphthalen-1-yl 2-(4-methoxyphenyl)-4-[(4-naphthalen-1-yloxycarbonyloxyphenyl)methyl]-5-oxo-1,3-oxazole-4-carboxylate.
| Compound Name | naphthalen-1-yl 2-(4-methoxyphenyl)-4-[(4-naphthalen-1-yloxycarbonyloxyphenyl)methyl]-5-oxo-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 53468965 |
| Molecular Formula | C39H27NO8 |
| Molecular Weight | 637.64 g/mol |
| Exact Mass | 637.17 |
| IUPAC Name | naphthalen-1-yl 2-(4-methoxyphenyl)-4-[(4-naphthalen-1-yloxycarbonyloxyphenyl)methyl]-5-oxo-1,3-oxazole-4-carboxylate |
| SMILES | COc1ccc(C2=NC(Cc3ccc(OC(=O)Oc4cccc5ccccc45)cc3)(C(=O)Oc3cccc4ccccc34)C(=O)O2)cc1 |
| InChI | InChI=1S/C39H27NO8/c1-44-29-22-18-28(19-23-29)35-40-39(37(42)48-35,36(41)46-33-14-6-10-26-8-2-4-12-31(26)33)24-25-16-20-30(21-17-25)45-38(43)47-34-15-7-11-27-9-3-5-13-32(27)34/h2-23H,24H2,1H3 |
| InChIKey | OIKCKJOLCOFPRK-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 109.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.64 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|